C19H20F2N4O4S — CID 142396116
(2R)-3-[[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]oxy]-3,3-difluoro-2-methylpropane-1,2-diol (PubChem CID 142396116) has the molecular formula C19H20F2N4O4S and a molecular weight of 438.46 g/mol. Its IUPAC name is (2R)-3-[[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]oxy]-3,3-difluoro-2-methylpropane-1,2-diol.
| Compound Name | (2R)-3-[[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]oxy]-3,3-difluoro-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 142396116 |
| Molecular Formula | C19H20F2N4O4S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (2R)-3-[[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]oxy]-3,3-difluoro-2-methylpropane-1,2-diol |
| SMILES | C[C@@](O)(CO)C(F)(F)Oc1ccc(-c2nccs2)c2oc(N3CC4CC(C3)N4)nc12 |
| InChI | InChI=1S/C19H20F2N4O4S/c1-18(27,9-26)19(20,21)29-13-3-2-12(16-22-4-5-30-16)15-14(13)24-17(28-15)25-7-10-6-11(8-25)23-10/h2-5,10-11,23,26-27H,6-9H2,1H3/t10?,11?,18-/m1/s1 |
| InChIKey | GWFMWLFQUTYNNB-IZMYHAASSA-N |
| XLogP | 2.22 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |