About 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol
2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol (PubChem CID 142396242) has the molecular formula C8H5BrF3NO4
and a molecular weight of 316.03 g/mol. Its IUPAC name is 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol.
Molecular Properties
| Compound Name | 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
| PubChem CID | 142396242 |
| Molecular Formula | C8H5BrF3NO4 |
| Molecular Weight | 316.03 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
| SMILES | O=[N+]([O-])c1cc(C(O)C(F)(F)F)cc(Br)c1O |
| InChI | InChI=1S/C8H5BrF3NO4/c9-4-1-3(7(15)8(10,11)12)2-5(6(4)14)13(16)17/h1-2,7,14-15H |
| InChIKey | KRMYIFHCFYHGSA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.03 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol?
The IUPAC name of 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol (CID 142396242) is 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol.
What is the SMILES notation for 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol?
The canonical SMILES for 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol is O=[N+]([O-])c1cc(C(O)C(F)(F)F)cc(Br)c1O.
What is the InChIKey of 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol?
The InChIKey is KRMYIFHCFYHGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF3NO4/c9-4-1-3(7(15)8(10,11)12)2-5(6(4)14)13(16)17/h1-2,7,14-15H.
What are the key properties of 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol?
2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol has a molecular weight of 316.03 g/mol, XLogP of 2.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-nitro-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol is sourced from PubChem (CID 142396242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).