C47H40N4 — CID 142397094
N-[(1Z,3Z,5Z)-1-[3-(7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)naphthalen-2-yl]hepta-1,3,5-trien-2-yl]-3-[N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-C-methylcarbonimidoyl]aniline (PubChem CID 142397094) has the molecular formula C47H40N4 and a molecular weight of 660.87 g/mol. Its IUPAC name is N-[(1Z,3Z,5Z)-1-[3-(7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)naphthalen-2-yl]hepta-1,3,5-trien-2-yl]-3-[N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-C-methylcarbonimidoyl]aniline.
| Compound Name | N-[(1Z,3Z,5Z)-1-[3-(7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)naphthalen-2-yl]hepta-1,3,5-trien-2-yl]-3-[N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-C-methylcarbonimidoyl]aniline |
|---|---|
| PubChem CID | 142397094 |
| Molecular Formula | C47H40N4 |
| Molecular Weight | 660.87 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | N-[(1Z,3Z,5Z)-1-[3-(7,8-diazabicyclo[4.2.0]octa-1,3,5-trien-7-yl)naphthalen-2-yl]hepta-1,3,5-trien-2-yl]-3-[N-[(1Z)-1,3-diphenylbuta-1,3-dienyl]-C-methylcarbonimidoyl]aniline |
| SMILES | C=C(/C=C(\N=C(/C)c1cccc(NC(/C=C\C=C/C)=C\c2cc3ccccc3cc2-n2[nH]c3ccccc32)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H40N4/c1-4-5-8-25-42(32-41-30-39-22-13-14-23-40(39)33-47(41)51-46-28-16-15-27-44(46)50-51)49-43-26-17-24-38(31-43)35(3)48-45(37-20-11-7-12-21-37)29-34(2)36-18-9-6-10-19-36/h4-33,49-50H,2H2,1,3H3/b5-4-,25-8-,42-32-,45-29-,48-35+ |
| InChIKey | WXPQTDYWCNGOHY-ISKURAHASA-N |
| XLogP | 12.26 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.87 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|