C21H31N — CID 142397437
ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4a,8a-dihydronaphthalen-1-amine (PubChem CID 142397437) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4a,8a-dihydronaphthalen-1-amine.
| Compound Name | ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4a,8a-dihydronaphthalen-1-amine |
|---|---|
| PubChem CID | 142397437 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4a,8a-dihydronaphthalen-1-amine |
| SMILES | C=C/C=C(\C=C/C)NC1=CC=CC2C=CC=CC12.CC.CC |
| InChI | InChI=1S/C17H19N.2C2H6/c1-3-8-15(9-4-2)18-17-13-7-11-14-10-5-6-12-16(14)17;2*1-2/h3-14,16,18H,1H2,2H3;2*1-2H3/b9-4-,15-8+;; |
| InChIKey | KDHZASCMVFIVQP-UEAGVLHJSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|