C11H17NO2 — CID 142397617
(2E,4E)-3,4-dimethyl-2-(methyliminomethyl)hepta-2,4-dienoic acid (PubChem CID 142397617) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2E,4E)-3,4-dimethyl-2-(methyliminomethyl)hepta-2,4-dienoic acid.
| Compound Name | (2E,4E)-3,4-dimethyl-2-(methyliminomethyl)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142397617 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2E,4E)-3,4-dimethyl-2-(methyliminomethyl)hepta-2,4-dienoic acid |
| SMILES | CC/C=C(C)/C(C)=C(\C=N\C)C(=O)O |
| InChI | InChI=1S/C11H17NO2/c1-5-6-8(2)9(3)10(7-12-4)11(13)14/h6-7H,5H2,1-4H3,(H,13,14)/b8-6+,10-9+,12-7+ |
| InChIKey | PNUJTSWRYDBKEU-NZTKFZGXSA-N |
| XLogP | 2.44 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|