C19H24N2O2 — CID 142397848
2-[(2E)-2-ethenylpenta-2,4-dienyl]-5,8a-dimethyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-7-carbonitrile (PubChem CID 142397848) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5,8a-dimethyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-7-carbonitrile.
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5,8a-dimethyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 142397848 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-5,8a-dimethyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-7-carbonitrile |
| SMILES | C=C/C=C(\C=C)CN1CCC2C(C)C(=O)C(C#N)CC2(C)C1=O |
| InChI | InChI=1S/C19H24N2O2/c1-5-7-14(6-2)12-21-9-8-16-13(3)17(22)15(11-20)10-19(16,4)18(21)23/h5-7,13,15-16H,1-2,8-10,12H2,3-4H3/b14-7+ |
| InChIKey | LVGKUGXFGBRBOR-VGOFMYFVSA-N |
| XLogP | 2.89 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|