C14H21NO3 — CID 142398011
(4aS)-2,5,5,8a-tetramethyl-1,6-dioxo-4,4a,7,8-tetrahydro-3H-isoquinoline-7-carbaldehyde (PubChem CID 142398011) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (4aS)-2,5,5,8a-tetramethyl-1,6-dioxo-4,4a,7,8-tetrahydro-3H-isoquinoline-7-carbaldehyde.
| Compound Name | (4aS)-2,5,5,8a-tetramethyl-1,6-dioxo-4,4a,7,8-tetrahydro-3H-isoquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 142398011 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (4aS)-2,5,5,8a-tetramethyl-1,6-dioxo-4,4a,7,8-tetrahydro-3H-isoquinoline-7-carbaldehyde |
| SMILES | CN1CC[C@H]2C(C)(C)C(=O)C(C=O)CC2(C)C1=O |
| InChI | InChI=1S/C14H21NO3/c1-13(2)10-5-6-15(4)12(18)14(10,3)7-9(8-16)11(13)17/h8-10H,5-7H2,1-4H3/t9?,10-,14?/m0/s1 |
| InChIKey | QXIMAHDZEBAZLM-XIRUVYRFSA-N |
| XLogP | 1.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|