C15H24O3 — CID 142398027
6-ethoxy-6-methoxy-1,4a-dimethyl-4,5,7,8-tetrahydro-3H-naphthalen-2-one (PubChem CID 142398027) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 6-ethoxy-6-methoxy-1,4a-dimethyl-4,5,7,8-tetrahydro-3H-naphthalen-2-one.
| Compound Name | 6-ethoxy-6-methoxy-1,4a-dimethyl-4,5,7,8-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 142398027 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 6-ethoxy-6-methoxy-1,4a-dimethyl-4,5,7,8-tetrahydro-3H-naphthalen-2-one |
| SMILES | CCOC1(OC)CCC2=C(C)C(=O)CCC2(C)C1 |
| InChI | InChI=1S/C15H24O3/c1-5-18-15(17-4)9-6-12-11(2)13(16)7-8-14(12,3)10-15/h5-10H2,1-4H3 |
| InChIKey | SENUICNLASMMKD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|