C22H42FN3O4 — CID 142398729
N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide (PubChem CID 142398729) has the molecular formula C22H42FN3O4 and a molecular weight of 431.59 g/mol. Its IUPAC name is N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide.
| Compound Name | N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide |
|---|---|
| PubChem CID | 142398729 |
| Molecular Formula | C22H42FN3O4 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | N-(7-amino-7-oxoheptyl)-N-fluoro-3-methoxy-5-methyl-4-[methyl(3-methylbutanoyl)amino]heptanamide |
| SMILES | CCC(C)C(C(CC(=O)N(F)CCCCCCC(N)=O)OC)N(C)C(=O)CC(C)C |
| InChI | InChI=1S/C22H42FN3O4/c1-7-17(4)22(25(5)20(28)14-16(2)3)18(30-6)15-21(29)26(23)13-11-9-8-10-12-19(24)27/h16-18,22H,7-15H2,1-6H3,(H2,24,27) |
| InChIKey | DLNDNQHLJDMARD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|