C19H36N2O2 — CID 142399847
ethane;1-(4-methoxyphenyl)-2-[2-methyl-5-(2-methylpropoxy)pentan-2-yl]hydrazine (PubChem CID 142399847) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is ethane;1-(4-methoxyphenyl)-2-[2-methyl-5-(2-methylpropoxy)pentan-2-yl]hydrazine.
| Compound Name | ethane;1-(4-methoxyphenyl)-2-[2-methyl-5-(2-methylpropoxy)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 142399847 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | ethane;1-(4-methoxyphenyl)-2-[2-methyl-5-(2-methylpropoxy)pentan-2-yl]hydrazine |
| SMILES | CC.COc1ccc(NNC(C)(C)CCCOCC(C)C)cc1 |
| InChI | InChI=1S/C17H30N2O2.C2H6/c1-14(2)13-21-12-6-11-17(3,4)19-18-15-7-9-16(20-5)10-8-15;1-2/h7-10,14,18-19H,6,11-13H2,1-5H3;1-2H3 |
| InChIKey | DIEHGEKYJUVDOS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|