C22H25N3O3 — CID 142400050
18-(5-nitro-2-pyridinyl)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-4-ol (PubChem CID 142400050) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 18-(5-nitro-2-pyridinyl)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-4-ol.
| Compound Name | 18-(5-nitro-2-pyridinyl)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 142400050 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 18-(5-nitro-2-pyridinyl)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-4-ol |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC34CCCCC3C2Cc2ccc(O)cc24)nc1 |
| InChI | InChI=1S/C22H25N3O3/c26-17-7-5-15-12-20-18-4-1-2-9-22(18,19(15)13-17)10-3-11-24(20)21-8-6-16(14-23-21)25(27)28/h5-8,13-14,18,20,26H,1-4,9-12H2 |
| InChIKey | RRNBQYIUZJFKMP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|