About methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen
methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen (PubChem CID 142400086) has the molecular formula C21H40N2O7
and a molecular weight of 432.56 g/mol. Its IUPAC name is methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen.
Molecular Properties
| Compound Name | methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen |
| PubChem CID | 142400086 |
| Molecular Formula | C21H40N2O7 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen |
| SMILES | CCCC[C@H](NC(=O)[C@H]1CCC(=O)C1)C(=O)OC.CCCC[C@H](NC=O)C(=O)OC.[H][H].[H][H] |
| InChI | InChI=1S/C13H21NO4.C8H15NO3.2H2/c1-3-4-5-11(13(17)18-2)14-12(16)9-6-7-10(15)8-9;1-3-4-5-7(9-6-10)8(11)12-2;;/h9,11H,3-8H2,1-2H3,(H,14,16);6-7H,3-5H2,1-2H3,(H,9,10);2*1H/t9-,11-;7-;;/m00../s1 |
| InChIKey | LMZDEVKZNMEAHR-HFJOJQMRSA-N |
| XLogP | 2.16 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen?
The IUPAC name of methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen (CID 142400086) is methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen.
What is the SMILES notation for methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen?
The canonical SMILES for methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen is CCCC[C@H](NC(=O)[C@H]1CCC(=O)C1)C(=O)OC.CCCC[C@H](NC=O)C(=O)OC.[H][H].[H][H].
What is the InChIKey of methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen?
The InChIKey is LMZDEVKZNMEAHR-HFJOJQMRSA-N. The full InChI is InChI=1S/C13H21NO4.C8H15NO3.2H2/c1-3-4-5-11(13(17)18-2)14-12(16)9-6-7-10(15)8-9;1-3-4-5-7(9-6-10)8(11)12-2;;/h9,11H,3-8H2,1-2H3,(H,14,16);6-7H,3-5H2,1-2H3,(H,9,10);2*1H/t9-,11-;7-;;/m00../s1.
What are the key properties of methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen?
methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen has a molecular weight of 432.56 g/mol, XLogP of 2.16, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-formamidohexanoate;methyl (2S)-2-[[(1S)-3-oxocyclopentanecarbonyl]amino]hexanoate;molecular hydrogen is sourced from PubChem (CID 142400086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).