C18H21N5O5S — CID 142400167
10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide (PubChem CID 142400167) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide.
| Compound Name | 10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
|---|---|
| PubChem CID | 142400167 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccccc3)nn2C)C2CN1C(=O)N2OSO |
| InChI | InChI=1S/C18H21N5O5S/c1-20(2)17(24)16-15-14(13-9-22(16)18(25)23(13)28-29-26)12(19-21(15)3)10-27-11-7-5-4-6-8-11/h4-8,13,16,26H,9-10H2,1-3H3 |
| InChIKey | XCQLCVCHJQTVNI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|