C17H22N8O5S — CID 142400171
10-hydroxysulfanyloxy-3-N,7-N,7-N,5-tetramethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide (PubChem CID 142400171) has the molecular formula C17H22N8O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 10-hydroxysulfanyloxy-3-N,7-N,7-N,5-tetramethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide.
| Compound Name | 10-hydroxysulfanyloxy-3-N,7-N,7-N,5-tetramethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide |
|---|---|
| PubChem CID | 142400171 |
| Molecular Formula | C17H22N8O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 10-hydroxysulfanyloxy-3-N,7-N,7-N,5-tetramethyl-3-N-(1-methylpyrazol-4-yl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide |
| SMILES | CN(C)C(=O)C1c2c(c(C(=O)N(C)c3cnn(C)c3)nn2C)C2CN1C(=O)N2OSO |
| InChI | InChI=1S/C17H22N8O5S/c1-20(2)16(27)14-13-11(10-8-24(14)17(28)25(10)30-31-29)12(19-23(13)5)15(26)22(4)9-6-18-21(3)7-9/h6-7,10,14,29H,8H2,1-5H3 |
| InChIKey | BMYZJSFNSPXJJA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|