C17H20N6O5S — CID 142400186
10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(pyridin-3-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide (PubChem CID 142400186) has the molecular formula C17H20N6O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is 10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(pyridin-3-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide.
| Compound Name | 10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(pyridin-3-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
|---|---|
| PubChem CID | 142400186 |
| Molecular Formula | C17H20N6O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 10-hydroxysulfanyloxy-N,N,5-trimethyl-9-oxo-3-(pyridin-3-yloxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
| SMILES | CN(C)C(=O)C1c2c(c(COc3cccnc3)nn2C)C2CN1C(=O)N2OSO |
| InChI | InChI=1S/C17H20N6O5S/c1-20(2)16(24)15-14-13(12-8-22(15)17(25)23(12)28-29-26)11(19-21(14)3)9-27-10-5-4-6-18-7-10/h4-7,12,15,26H,8-9H2,1-3H3 |
| InChIKey | DYHAIVIQGLPPJO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|