About 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene
5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene (PubChem CID 142400255) has the molecular formula C19H22
and a molecular weight of 250.38 g/mol. Its IUPAC name is 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene |
| PubChem CID | 142400255 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene |
| SMILES | C=Cc1ccc(CC2C3C=CC(C3)C2C)cc1C=C |
| InChI | InChI=1S/C19H22/c1-4-15-7-6-14(10-16(15)5-2)11-19-13(3)17-8-9-18(19)12-17/h4-10,13,17-19H,1-2,11-12H2,3H3 |
| InChIKey | ZBCGLWPXYZTGIC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene (CID 142400255) is 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene is C=Cc1ccc(CC2C3C=CC(C3)C2C)cc1C=C.
What is the InChIKey of 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene?
The InChIKey is ZBCGLWPXYZTGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22/c1-4-15-7-6-14(10-16(15)5-2)11-19-13(3)17-8-9-18(19)12-17/h4-10,13,17-19H,1-2,11-12H2,3H3.
What are the key properties of 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene?
5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene has a molecular weight of 250.38 g/mol, XLogP of 4.97, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3,4-bis(ethenyl)phenyl]methyl]-6-methylbicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 142400255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).