C17H26O4 — CID 14240028
dimethyl (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate (PubChem CID 14240028) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is dimethyl (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate.
| Compound Name | dimethyl (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14240028 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | dimethyl (4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(C)CCCC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C17H26O4/c1-16(2)9-6-10-17(3)12(16)8-7-11(14(18)20-4)13(17)15(19)21-5/h12H,6-10H2,1-5H3/t12-,17-/m0/s1 |
| InChIKey | YYRKLIBMJPVYGR-SJCJKPOMSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |