C31H47N3O2 — CID 142400610
ethene;3-[[(4E,6Z,8Z)-7-methyldeca-4,6,8-trienyl]amino]-4-[1-[4-methyl-5-[(Z)-prop-1-enyl]cyclopenta-1,4-dien-1-yl]propan-2-ylamino]cyclobut-3-ene-1,2-dione;N-methylmethanamine (PubChem CID 142400610) has the molecular formula C31H47N3O2 and a molecular weight of 493.74 g/mol. Its IUPAC name is ethene;3-[[(4E,6Z,8Z)-7-methyldeca-4,6,8-trienyl]amino]-4-[1-[4-methyl-5-[(Z)-prop-1-enyl]cyclopenta-1,4-dien-1-yl]propan-2-ylamino]cyclobut-3-ene-1,2-dione;N-methylmethanamine.
| Compound Name | ethene;3-[[(4E,6Z,8Z)-7-methyldeca-4,6,8-trienyl]amino]-4-[1-[4-methyl-5-[(Z)-prop-1-enyl]cyclopenta-1,4-dien-1-yl]propan-2-ylamino]cyclobut-3-ene-1,2-dione;N-methylmethanamine |
|---|---|
| PubChem CID | 142400610 |
| Molecular Formula | C31H47N3O2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.37 |
| IUPAC Name | ethene;3-[[(4E,6Z,8Z)-7-methyldeca-4,6,8-trienyl]amino]-4-[1-[4-methyl-5-[(Z)-prop-1-enyl]cyclopenta-1,4-dien-1-yl]propan-2-ylamino]cyclobut-3-ene-1,2-dione;N-methylmethanamine |
| SMILES | C/C=C\C1=C(C)CC=C1CC(C)Nc1c(NCCC/C=C/C=C(C)\C=C/C)c(=O)c1=O.C=C.CNC |
| InChI | InChI=1S/C27H36N2O2.C2H7N.C2H4/c1-6-12-19(3)14-10-8-9-11-17-28-24-25(27(31)26(24)30)29-21(5)18-22-16-15-20(4)23(22)13-7-2;1-3-2;1-2/h6-8,10,12-14,16,21,28-29H,9,11,15,17-18H2,1-5H3;3H,1-2H3;1-2H2/b10-8+,12-6-,13-7-,19-14-;; |
| InChIKey | XTANETPZDQRYMT-NRDDJIJJSA-N |
| XLogP | 6.60 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|