C29H33F2N5O3 — CID 142400724
2-cyclohexa-2,4-dien-1-yl-N-[[(3S)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]methyl]-2,2-difluoroacetamide (PubChem CID 142400724) has the molecular formula C29H33F2N5O3 and a molecular weight of 537.61 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-N-[[(3S)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-N-[[(3S)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 142400724 |
| Molecular Formula | C29H33F2N5O3 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-N-[[(3S)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]methyl]-2,2-difluoroacetamide |
| SMILES | COc1ccc(-c2c(C)nc3c(N4CC[C@@H](CNC(=O)C(F)(F)C5C=CC=CC5)C4)cc(C)nn23)cc1OC |
| InChI | InChI=1S/C29H33F2N5O3/c1-18-14-23(27-33-19(2)26(36(27)34-18)21-10-11-24(38-3)25(15-21)39-4)35-13-12-20(17-35)16-32-28(37)29(30,31)22-8-6-5-7-9-22/h5-8,10-11,14-15,20,22H,9,12-13,16-17H2,1-4H3,(H,32,37)/t20-,22?/m0/s1 |
| InChIKey | KINNKAVRQBKARE-AIBWNMTMSA-N |
| XLogP | 4.74 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |