C27H25F3N2O2 — CID 142400838
1,2-dimethyl-4-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]phenoxazin-3-one (PubChem CID 142400838) has the molecular formula C27H25F3N2O2 and a molecular weight of 466.50 g/mol. Its IUPAC name is 1,2-dimethyl-4-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]phenoxazin-3-one.
| Compound Name | 1,2-dimethyl-4-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]phenoxazin-3-one |
|---|---|
| PubChem CID | 142400838 |
| Molecular Formula | C27H25F3N2O2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1,2-dimethyl-4-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]phenoxazin-3-one |
| SMILES | Cc1c2nc3ccccc3oc-2c(-c2ccc(C3CCN(CC(F)(F)F)CC3)cc2)c(=O)c1C |
| InChI | InChI=1S/C27H25F3N2O2/c1-16-17(2)25(33)23(26-24(16)31-21-5-3-4-6-22(21)34-26)20-9-7-18(8-10-20)19-11-13-32(14-12-19)15-27(28,29)30/h3-10,19H,11-15H2,1-2H3 |
| InChIKey | PNTSQENEVVQOCH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|