C14H22 — CID 142400897
ethane;1,4,6-trimethyl-2,3-dihydro-1H-indene (PubChem CID 142400897) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is ethane;1,4,6-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | ethane;1,4,6-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 142400897 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | ethane;1,4,6-trimethyl-2,3-dihydro-1H-indene |
| SMILES | CC.Cc1cc(C)c2c(c1)C(C)CC2 |
| InChI | InChI=1S/C12H16.C2H6/c1-8-6-10(3)11-5-4-9(2)12(11)7-8;1-2/h6-7,9H,4-5H2,1-3H3;1-2H3 |
| InChIKey | WNQSOEHWKQTPSI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |