C17H32O — CID 142400933
ethane;1-(1,3,3,5-tetramethyl-5-prop-1-en-2-ylcyclohexyl)ethanone (PubChem CID 142400933) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is ethane;1-(1,3,3,5-tetramethyl-5-prop-1-en-2-ylcyclohexyl)ethanone.
| Compound Name | ethane;1-(1,3,3,5-tetramethyl-5-prop-1-en-2-ylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 142400933 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | ethane;1-(1,3,3,5-tetramethyl-5-prop-1-en-2-ylcyclohexyl)ethanone |
| SMILES | C=C(C)C1(C)CC(C)(C)CC(C)(C(C)=O)C1.CC |
| InChI | InChI=1S/C15H26O.C2H6/c1-11(2)14(6)8-13(4,5)9-15(7,10-14)12(3)16;1-2/h1,8-10H2,2-7H3;1-2H3 |
| InChIKey | LXANRPOXUSOBSC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|