About ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine
ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine (PubChem CID 142400939) has the molecular formula C15H35N3O2
and a molecular weight of 289.46 g/mol. Its IUPAC name is ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine |
| PubChem CID | 142400939 |
| Molecular Formula | C15H35N3O2 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.27 |
| IUPAC Name | ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine |
| SMILES | CC.CCOCCCNC(C)=O.CN1CCC(N)CC1 |
| InChI | InChI=1S/C7H15NO2.C6H14N2.C2H6/c1-3-10-6-4-5-8-7(2)9;1-8-4-2-6(7)3-5-8;1-2/h3-6H2,1-2H3,(H,8,9);6H,2-5,7H2,1H3;1-2H3 |
| InChIKey | WGYJHSCKXJYICQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine?
The IUPAC name of ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine (CID 142400939) is ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine.
What is the SMILES notation for ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine?
The canonical SMILES for ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine is CC.CCOCCCNC(C)=O.CN1CCC(N)CC1.
What is the InChIKey of ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine?
The InChIKey is WGYJHSCKXJYICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C6H14N2.C2H6/c1-3-10-6-4-5-8-7(2)9;1-8-4-2-6(7)3-5-8;1-2/h3-6H2,1-2H3,(H,8,9);6H,2-5,7H2,1H3;1-2H3.
What are the key properties of ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine?
ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine has a molecular weight of 289.46 g/mol, XLogP of 1.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(3-ethoxypropyl)acetamide;1-methylpiperidin-4-amine is sourced from PubChem (CID 142400939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).