C28H26F2N8O2SSi — CID 142401328
2,2-difluoro-N-[6-[[1-(1-methyltetrazol-5-yl)-6-(2-trimethylsilylethynyl)benzimidazol-2-yl]sulfanylmethyl]-2-pyridinyl]-2-phenoxyacetamide (PubChem CID 142401328) has the molecular formula C28H26F2N8O2SSi and a molecular weight of 604.72 g/mol. Its IUPAC name is 2,2-difluoro-N-[6-[[1-(1-methyltetrazol-5-yl)-6-(2-trimethylsilylethynyl)benzimidazol-2-yl]sulfanylmethyl]-2-pyridinyl]-2-phenoxyacetamide.
| Compound Name | 2,2-difluoro-N-[6-[[1-(1-methyltetrazol-5-yl)-6-(2-trimethylsilylethynyl)benzimidazol-2-yl]sulfanylmethyl]-2-pyridinyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 142401328 |
| Molecular Formula | C28H26F2N8O2SSi |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 2,2-difluoro-N-[6-[[1-(1-methyltetrazol-5-yl)-6-(2-trimethylsilylethynyl)benzimidazol-2-yl]sulfanylmethyl]-2-pyridinyl]-2-phenoxyacetamide |
| SMILES | Cn1nnnc1-n1c(SCc2cccc(NC(=O)C(F)(F)Oc3ccccc3)n2)nc2ccc(C#C[Si](C)(C)C)cc21 |
| InChI | InChI=1S/C28H26F2N8O2SSi/c1-37-26(34-35-36-37)38-23-17-19(15-16-42(2,3)4)13-14-22(23)32-27(38)41-18-20-9-8-12-24(31-20)33-25(39)28(29,30)40-21-10-6-5-7-11-21/h5-14,17H,18H2,1-4H3,(H,31,33,39) |
| InChIKey | VTIYWEHZTASILH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|