C21H12F7N3O — CID 142401428
3,5-difluoro-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol (PubChem CID 142401428) has the molecular formula C21H12F7N3O and a molecular weight of 455.33 g/mol. Its IUPAC name is 3,5-difluoro-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol.
| Compound Name | 3,5-difluoro-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol |
|---|---|
| PubChem CID | 142401428 |
| Molecular Formula | C21H12F7N3O |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3,5-difluoro-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol |
| SMILES | Cc1nc2cnc(-c3cccc(C(F)(F)C(F)(F)F)c3)cn2c1-c1c(F)cc(O)cc1F |
| InChI | InChI=1S/C21H12F7N3O/c1-10-19(18-14(22)6-13(32)7-15(18)23)31-9-16(29-8-17(31)30-10)11-3-2-4-12(5-11)20(24,25)21(26,27)28/h2-9,32H,1H3 |
| InChIKey | SKWVYWISDSZRAU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|