C22H22N6O — CID 142401513
1-[9-(ethoxymethyl)-15-ethynyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]-3-methylbut-2-en-1-imine (PubChem CID 142401513) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[9-(ethoxymethyl)-15-ethynyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]-3-methylbut-2-en-1-imine.
| Compound Name | 1-[9-(ethoxymethyl)-15-ethynyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]-3-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142401513 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-[9-(ethoxymethyl)-15-ethynyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]-3-methylbut-2-en-1-imine |
| SMILES | [H]/N=C(\C=C(C)C)c1ncn2c1Cn1c(COCC)nnc1-c1cc(C#C)ccc1-2 |
| InChI | InChI=1S/C22H22N6O/c1-5-15-7-8-18-16(10-15)22-26-25-20(12-29-6-2)27(22)11-19-21(24-13-28(18)19)17(23)9-14(3)4/h1,7-10,13,23H,6,11-12H2,2-4H3/b23-17+ |
| InChIKey | DUJPIPVBASJTSH-HAVVHWLPSA-N |
| XLogP | 3.34 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|