C24H27ClN6O2 — CID 142401621
(5Z)-5-(1-amino-2-methoxyethylidene)-8-chloro-3-[(4S)-4-(cyclohexa-1,5-dien-1-ylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine (PubChem CID 142401621) has the molecular formula C24H27ClN6O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is (5Z)-5-(1-amino-2-methoxyethylidene)-8-chloro-3-[(4S)-4-(cyclohexa-1,5-dien-1-ylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine.
| Compound Name | (5Z)-5-(1-amino-2-methoxyethylidene)-8-chloro-3-[(4S)-4-(cyclohexa-1,5-dien-1-ylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine |
|---|---|
| PubChem CID | 142401621 |
| Molecular Formula | C24H27ClN6O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (5Z)-5-(1-amino-2-methoxyethylidene)-8-chloro-3-[(4S)-4-(cyclohexa-1,5-dien-1-ylmethyl)-4,5-dihydro-1,3-oxazol-2-yl]-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine |
| SMILES | COC/C(N)=C1\Cc2c(C3=N[C@@H](CC4=CCCC=C4)CO3)ncn2-c2ccc(Cl)cc2N1N |
| InChI | InChI=1S/C24H27ClN6O2/c1-32-13-18(26)20-11-22-23(24-29-17(12-33-24)9-15-5-3-2-4-6-15)28-14-30(22)19-8-7-16(25)10-21(19)31(20)27/h3,5-8,10,14,17H,2,4,9,11-13,26-27H2,1H3/b20-18-/t17-/m0/s1 |
| InChIKey | XKKSQRJXLIDYEL-VGVBMJIYSA-N |
| XLogP | 3.39 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|