About (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine
(5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine (PubChem CID 142401669) has the molecular formula C14H12ClN5
and a molecular weight of 285.74 g/mol. Its IUPAC name is (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine.
Molecular Properties
| Compound Name | (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine |
| PubChem CID | 142401669 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine |
| SMILES | C#Cc1ncn2c1C/C(=C/N)N(N)c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C14H12ClN5/c1-2-11-13-6-10(7-16)20(17)14-5-9(15)3-4-12(14)19(13)8-18-11/h1,3-5,7-8H,6,16-17H2/b10-7- |
| InChIKey | DOAOCVGKVSAOEJ-YFHOEESVSA-N |
| XLogP | 1.54 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine?
The IUPAC name of (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine (CID 142401669) is (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine.
What is the SMILES notation for (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine?
The canonical SMILES for (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine is C#Cc1ncn2c1C/C(=C/N)N(N)c1cc(Cl)ccc1-2.
What is the InChIKey of (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine?
The InChIKey is DOAOCVGKVSAOEJ-YFHOEESVSA-N. The full InChI is InChI=1S/C14H12ClN5/c1-2-11-13-6-10(7-16)20(17)14-5-9(15)3-4-12(14)19(13)8-18-11/h1,3-5,7-8H,6,16-17H2/b10-7-.
What are the key properties of (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine?
(5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine has a molecular weight of 285.74 g/mol, XLogP of 1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(aminomethylidene)-8-chloro-3-ethynyl-4H-imidazo[1,5-a][1,5]benzodiazepin-6-amine is sourced from PubChem (CID 142401669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).