About N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine
N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine (PubChem CID 142401679) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine.
Molecular Properties
| Compound Name | N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine |
| PubChem CID | 142401679 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine |
| SMILES | C=C/C(C)=C\N=C=N/C=C(\C)C=C |
| InChI | InChI=1S/C11H14N2/c1-5-10(3)7-12-9-13-8-11(4)6-2/h5-8H,1-2H2,3-4H3/b10-7-,11-8+ |
| InChIKey | YXVUPSSFTGXWBE-BDLVGCLISA-N |
| XLogP | 3.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine?
The IUPAC name of N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine (CID 142401679) is N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine.
What is the SMILES notation for N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine?
The canonical SMILES for N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine is C=C/C(C)=C\N=C=N/C=C(\C)C=C.
What is the InChIKey of N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine?
The InChIKey is YXVUPSSFTGXWBE-BDLVGCLISA-N. The full InChI is InChI=1S/C11H14N2/c1-5-10(3)7-12-9-13-8-11(4)6-2/h5-8H,1-2H2,3-4H3/b10-7-,11-8+.
What are the key properties of N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine?
N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine has a molecular weight of 174.25 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-2-methylbuta-1,3-dienyl]-N'-[(1Z)-2-methylbuta-1,3-dienyl]methanediimine is sourced from PubChem (CID 142401679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).