About N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine
N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine (PubChem CID 142401903) has the molecular formula C16H32N4O
and a molecular weight of 296.46 g/mol. Its IUPAC name is N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine |
| PubChem CID | 142401903 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine |
| SMILES | CCCC(CC)NCCCNCCCc1coc(CN)n1 |
| InChI | InChI=1S/C16H32N4O/c1-3-7-14(4-2)19-11-6-10-18-9-5-8-15-13-21-16(12-17)20-15/h13-14,18-19H,3-12,17H2,1-2H3 |
| InChIKey | IXLOYWAGWRXCAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine?
The IUPAC name of N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine (CID 142401903) is N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine.
What is the SMILES notation for N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine?
The canonical SMILES for N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine is CCCC(CC)NCCCNCCCc1coc(CN)n1.
What is the InChIKey of N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine?
The InChIKey is IXLOYWAGWRXCAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4O/c1-3-7-14(4-2)19-11-6-10-18-9-5-8-15-13-21-16(12-17)20-15/h13-14,18-19H,3-12,17H2,1-2H3.
What are the key properties of N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine?
N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine has a molecular weight of 296.46 g/mol, XLogP of 2.21, 13 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2-(aminomethyl)-1,3-oxazol-4-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine is sourced from PubChem (CID 142401903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).