C15H14BrF5N2O2 — CID 142402592
6-bromo-8-methyl-4'-(1,1,2,2,2-pentafluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,1'-cyclohexane]-1,5-dione (PubChem CID 142402592) has the molecular formula C15H14BrF5N2O2 and a molecular weight of 429.18 g/mol. Its IUPAC name is 6-bromo-8-methyl-4'-(1,1,2,2,2-pentafluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,1'-cyclohexane]-1,5-dione.
| Compound Name | 6-bromo-8-methyl-4'-(1,1,2,2,2-pentafluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,1'-cyclohexane]-1,5-dione |
|---|---|
| PubChem CID | 142402592 |
| Molecular Formula | C15H14BrF5N2O2 |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 6-bromo-8-methyl-4'-(1,1,2,2,2-pentafluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,1'-cyclohexane]-1,5-dione |
| SMILES | Cc1cc(Br)c(=O)n2c1C(=O)NC21CCC(C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H14BrF5N2O2/c1-7-6-9(16)12(25)23-10(7)11(24)22-13(23)4-2-8(3-5-13)14(17,18)15(19,20)21/h6,8H,2-5H2,1H3,(H,22,24) |
| InChIKey | BMCHLZNIYPAWLI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|