C12H10N2O10S4 — CID 142403397
2-amino-6-methoxybenzo[e][1,3]benzothiazole-4,7,8-trisulfonic acid (PubChem CID 142403397) has the molecular formula C12H10N2O10S4 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-amino-6-methoxybenzo[e][1,3]benzothiazole-4,7,8-trisulfonic acid.
| Compound Name | 2-amino-6-methoxybenzo[e][1,3]benzothiazole-4,7,8-trisulfonic acid |
|---|---|
| PubChem CID | 142403397 |
| Molecular Formula | C12H10N2O10S4 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 469.92 |
| IUPAC Name | 2-amino-6-methoxybenzo[e][1,3]benzothiazole-4,7,8-trisulfonic acid |
| SMILES | COc1c(S(=O)(=O)O)c(S(=O)(=O)O)cc2c1cc(S(=O)(=O)O)c1sc(N)nc12 |
| InChI | InChI=1S/C12H10N2O10S4/c1-24-9-5-3-6(26(15,16)17)10-8(14-12(13)25-10)4(5)2-7(27(18,19)20)11(9)28(21,22)23/h2-3H,1H3,(H2,13,14)(H,15,16,17)(H,18,19,20)(H,21,22,23) |
| InChIKey | FQIZBWQEVWNYSU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 211.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|