C15H21NS — CID 142403733
ethane;5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyridine-3-thiol (PubChem CID 142403733) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is ethane;5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyridine-3-thiol.
| Compound Name | ethane;5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyridine-3-thiol |
|---|---|
| PubChem CID | 142403733 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | ethane;5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyridine-3-thiol |
| SMILES | C=C/C(C)=C\C=C(/C)c1cncc(S)c1.CC |
| InChI | InChI=1S/C13H15NS.C2H6/c1-4-10(2)5-6-11(3)12-7-13(15)9-14-8-12;1-2/h4-9,15H,1H2,2-3H3;1-2H3/b10-5-,11-6+; |
| InChIKey | XTVDGTPEBVAHLU-BINALKEJSA-N |
| XLogP | 4.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|