C20H36O3 — CID 14240398
(E,4S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-ene-1,4-diol (PubChem CID 14240398) has the molecular formula C20H36O3 and a molecular weight of 324.50 g/mol. Its IUPAC name is (E,4S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-ene-1,4-diol.
| Compound Name | (E,4S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-ene-1,4-diol |
|---|---|
| PubChem CID | 14240398 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (E,4S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-ene-1,4-diol |
| SMILES | C/C(=C\CO)[C@@H](O)C[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C20H36O3/c1-14(8-12-21)15(22)13-17-19(4)10-6-9-18(2,3)16(19)7-11-20(17,5)23/h8,15-17,21-23H,6-7,9-13H2,1-5H3/b14-8+/t15-,16-,17+,19-,20+/m0/s1 |
| InChIKey | AWCMRYGZCXYBDX-JTXWAJLESA-N |
| XLogP | 3.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|