About 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine
4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 142404018) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 142404018 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C(C)(C)C1=CCN(C)CC1 |
| InChI | InChI=1S/C12H23N/c1-10(2)12(3,4)11-6-8-13(5)9-7-11/h6,10H,7-9H2,1-5H3 |
| InChIKey | CHPZMLZFCHVJNA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine (CID 142404018) is 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine is CC(C)C(C)(C)C1=CCN(C)CC1.
What is the InChIKey of 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is CHPZMLZFCHVJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-10(2)12(3,4)11-6-8-13(5)9-7-11/h6,10H,7-9H2,1-5H3.
What are the key properties of 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 181.32 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylbutan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 142404018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).