About (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone
(2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 142404137) has the molecular formula C12H16F2N2O
and a molecular weight of 242.27 g/mol. Its IUPAC name is (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 142404137 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2=C(F)CCC=C2F)CC1 |
| InChI | InChI=1S/C12H16F2N2O/c1-15-5-7-16(8-6-15)12(17)11-9(13)3-2-4-10(11)14/h3H,2,4-8H2,1H3 |
| InChIKey | RKKQTMVUSFGLLO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone (CID 142404137) is (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone is CN1CCN(C(=O)C2=C(F)CCC=C2F)CC1.
What is the InChIKey of (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone?
The InChIKey is RKKQTMVUSFGLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2O/c1-15-5-7-16(8-6-15)12(17)11-9(13)3-2-4-10(11)14/h3H,2,4-8H2,1H3.
What are the key properties of (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone?
(2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone has a molecular weight of 242.27 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorocyclohexa-1,5-dien-1-yl)-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 142404137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).