About ethane;3-methyl-1,2-thiazole-5-carbonitrile
ethane;3-methyl-1,2-thiazole-5-carbonitrile (PubChem CID 142404190) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is ethane;3-methyl-1,2-thiazole-5-carbonitrile.
Molecular Properties
| Compound Name | ethane;3-methyl-1,2-thiazole-5-carbonitrile |
| PubChem CID | 142404190 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | ethane;3-methyl-1,2-thiazole-5-carbonitrile |
| SMILES | CC.Cc1cc(C#N)sn1 |
| InChI | InChI=1S/C5H4N2S.C2H6/c1-4-2-5(3-6)8-7-4;1-2/h2H,1H3;1-2H3 |
| InChIKey | IANMWNMSUKDQQG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methyl-1,2-thiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1,2-thiazole-5-carbonitrile?
The IUPAC name of ethane;3-methyl-1,2-thiazole-5-carbonitrile (CID 142404190) is ethane;3-methyl-1,2-thiazole-5-carbonitrile.
What is the SMILES notation for ethane;3-methyl-1,2-thiazole-5-carbonitrile?
The canonical SMILES for ethane;3-methyl-1,2-thiazole-5-carbonitrile is CC.Cc1cc(C#N)sn1.
What is the InChIKey of ethane;3-methyl-1,2-thiazole-5-carbonitrile?
The InChIKey is IANMWNMSUKDQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S.C2H6/c1-4-2-5(3-6)8-7-4;1-2/h2H,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1,2-thiazole-5-carbonitrile?
ethane;3-methyl-1,2-thiazole-5-carbonitrile has a molecular weight of 154.24 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1,2-thiazole-5-carbonitrile is sourced from PubChem (CID 142404190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).