C35H42F4N2OS — CID 142404678
5-[(4-cyclohexylphenyl)methyl-[3-[propyl-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylamino]prop-1-en-2-yl]amino]-2-methylphenol;ethene (PubChem CID 142404678) has the molecular formula C35H42F4N2OS and a molecular weight of 614.79 g/mol. Its IUPAC name is 5-[(4-cyclohexylphenyl)methyl-[3-[propyl-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylamino]prop-1-en-2-yl]amino]-2-methylphenol;ethene.
| Compound Name | 5-[(4-cyclohexylphenyl)methyl-[3-[propyl-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylamino]prop-1-en-2-yl]amino]-2-methylphenol;ethene |
|---|---|
| PubChem CID | 142404678 |
| Molecular Formula | C35H42F4N2OS |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | 5-[(4-cyclohexylphenyl)methyl-[3-[propyl-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylamino]prop-1-en-2-yl]amino]-2-methylphenol;ethene |
| SMILES | C=C.C=C(CN(CCC)Sc1c(F)c(F)c(C)c(F)c1F)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C)c(O)c1 |
| InChI | InChI=1S/C33H38F4N2OS.C2H4/c1-5-17-38(41-33-31(36)29(34)23(4)30(35)32(33)37)19-22(3)39(27-16-11-21(2)28(40)18-27)20-24-12-14-26(15-13-24)25-9-7-6-8-10-25;1-2/h11-16,18,25,40H,3,5-10,17,19-20H2,1-2,4H3;1-2H2 |
| InChIKey | KWOSXWPQKLYVCZ-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|