C32H33F6N4OS+ — CID 142404710
[2-amino-4-[(4-cyclohexylphenyl)methyl-[(2R)-1-[(E)-ethylidene-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl]azetidine-2-carbonyl]amino]-3-fluorophenyl]methylideneazanium (PubChem CID 142404710) has the molecular formula C32H33F6N4OS+ and a molecular weight of 635.70 g/mol. Its IUPAC name is [2-amino-4-[(4-cyclohexylphenyl)methyl-[(2R)-1-[(E)-ethylidene-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl]azetidine-2-carbonyl]amino]-3-fluorophenyl]methylideneazanium.
| Compound Name | [2-amino-4-[(4-cyclohexylphenyl)methyl-[(2R)-1-[(E)-ethylidene-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl]azetidine-2-carbonyl]amino]-3-fluorophenyl]methylideneazanium |
|---|---|
| PubChem CID | 142404710 |
| Molecular Formula | C32H33F6N4OS+ |
| Molecular Weight | 635.70 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | [2-amino-4-[(4-cyclohexylphenyl)methyl-[(2R)-1-[(E)-ethylidene-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl]azetidine-2-carbonyl]amino]-3-fluorophenyl]methylideneazanium |
| SMILES | C/C=S(\c1c(F)c(F)c(F)c(F)c1F)N1CC[C@@H]1C(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C=[NH2+])c(N)c1F |
| InChI | InChI=1S/C32H32F6N4OS/c1-2-44(31-28(37)26(35)25(34)27(36)29(31)38)42-15-14-23(42)32(43)41(22-13-12-21(16-39)30(40)24(22)33)17-18-8-10-20(11-9-18)19-6-4-3-5-7-19/h2,8-13,16,19,23,39H,3-7,14-15,17,40H2,1H3/p+1/t23-,44?/m1/s1 |
| InChIKey | YLIHIEOQXVWECG-NBWDXOLFSA-O |
| XLogP | 6.00 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|