C18H22N2O4 — CID 142404742
2-[[[(2E,4E)-2-ethenyl-5-methoxyhexa-2,4-dienyl]-methylamino]methyl]-4-nitrobenzaldehyde (PubChem CID 142404742) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[[[(2E,4E)-2-ethenyl-5-methoxyhexa-2,4-dienyl]-methylamino]methyl]-4-nitrobenzaldehyde.
| Compound Name | 2-[[[(2E,4E)-2-ethenyl-5-methoxyhexa-2,4-dienyl]-methylamino]methyl]-4-nitrobenzaldehyde |
|---|---|
| PubChem CID | 142404742 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[[[(2E,4E)-2-ethenyl-5-methoxyhexa-2,4-dienyl]-methylamino]methyl]-4-nitrobenzaldehyde |
| SMILES | C=C/C(=C\C=C(/C)OC)CN(C)Cc1cc([N+](=O)[O-])ccc1C=O |
| InChI | InChI=1S/C18H22N2O4/c1-5-15(7-6-14(2)24-4)11-19(3)12-17-10-18(20(22)23)9-8-16(17)13-21/h5-10,13H,1,11-12H2,2-4H3/b14-6+,15-7+ |
| InChIKey | OJIHWYFKPWVWGT-MKFXEVHTSA-N |
| XLogP | 3.50 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|