C16H22F5NO2S — CID 142404785
2-methoxy-2-methylpropane;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanal (PubChem CID 142404785) has the molecular formula C16H22F5NO2S and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanal.
| Compound Name | 2-methoxy-2-methylpropane;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanal |
|---|---|
| PubChem CID | 142404785 |
| Molecular Formula | C16H22F5NO2S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-methoxy-2-methylpropane;2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanal |
| SMILES | CCC(C=O)N(C)Sc1c(F)c(F)c(F)c(F)c1F.COC(C)(C)C |
| InChI | InChI=1S/C11H10F5NOS.C5H12O/c1-3-5(4-18)17(2)19-11-9(15)7(13)6(12)8(14)10(11)16;1-5(2,3)6-4/h4-5H,3H2,1-2H3;1-4H3 |
| InChIKey | RXZNUGJTMRWJJD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|