C26H30F3N5O2S — CID 142405196
N-[1-(1H-indol-3-yl)hexan-2-yl]formamide;5-(5-methyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine (PubChem CID 142405196) has the molecular formula C26H30F3N5O2S and a molecular weight of 533.62 g/mol. Its IUPAC name is N-[1-(1H-indol-3-yl)hexan-2-yl]formamide;5-(5-methyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine.
| Compound Name | N-[1-(1H-indol-3-yl)hexan-2-yl]formamide;5-(5-methyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 142405196 |
| Molecular Formula | C26H30F3N5O2S |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[1-(1H-indol-3-yl)hexan-2-yl]formamide;5-(5-methyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine |
| SMILES | CCCCC(Cc1c[nH]c2ccccc12)NC=O.Cc1cnc(N2CCc3onc(C(F)(F)F)c3C2)s1 |
| InChI | InChI=1S/C15H20N2O.C11H10F3N3OS/c1-2-3-6-13(17-11-18)9-12-10-16-15-8-5-4-7-14(12)15;1-6-4-15-10(19-6)17-3-2-8-7(5-17)9(16-18-8)11(12,13)14/h4-5,7-8,10-11,13,16H,2-3,6,9H2,1H3,(H,17,18);4H,2-3,5H2,1H3 |
| InChIKey | ISZPONABBQOIKG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|