C25H53B3O6 — CID 142405759
5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane (PubChem CID 142405759) has the molecular formula C25H53B3O6 and a molecular weight of 482.13 g/mol. Its IUPAC name is 5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 142405759 |
| Molecular Formula | C25H53B3O6 |
| Molecular Weight | 482.13 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | 5,5-dimethyl-2-propan-2-yl-1,3,2-dioxaborinane;2-ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,6-trimethyl-2-propan-2-yl-1,3,2-dioxaborinane |
| SMILES | CC(C)B1OCC(C)(C)CO1.CC1CC(C)(C)OB(C(C)C)O1.CCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C9H19BO2.2C8H17BO2/c1-7(2)10-11-8(3)6-9(4,5)12-10;1-7(2)9-10-5-8(3,4)6-11-9;1-6-9-10-7(2,3)8(4,5)11-9/h7-8H,6H2,1-5H3;7H,5-6H2,1-4H3;6H2,1-5H3 |
| InChIKey | AMKLVCPQSCNFHY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.13 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|