C22H24N6O2 — CID 142406252
benzyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate (PubChem CID 142406252) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is benzyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate.
| Compound Name | benzyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 142406252 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | benzyl N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
| SMILES | Cc1nnc2c(NCCCCNC(=O)OCc3ccccc3)nc3ccccc3n12 |
| InChI | InChI=1S/C22H24N6O2/c1-16-26-27-21-20(25-18-11-5-6-12-19(18)28(16)21)23-13-7-8-14-24-22(29)30-15-17-9-3-2-4-10-17/h2-6,9-12H,7-8,13-15H2,1H3,(H,23,25)(H,24,29) |
| InChIKey | BJEKUWFZICLXLH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|