C23H27N7O3 — CID 142406388
N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]pyridine-2-carboxamide (PubChem CID 142406388) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]pyridine-2-carboxamide.
| Compound Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142406388 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]pyridine-2-carboxamide |
| SMILES | COCCOc1ccc2c(c1)nc(NCCCCNC(=O)c1ccccn1)c1nnc(C)n12 |
| InChI | InChI=1S/C23H27N7O3/c1-16-28-29-22-21(25-11-5-6-12-26-23(31)18-7-3-4-10-24-18)27-19-15-17(33-14-13-32-2)8-9-20(19)30(16)22/h3-4,7-10,15H,5-6,11-14H2,1-2H3,(H,25,27)(H,26,31) |
| InChIKey | AJSLXZLNCIZAEJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|