C22H28N8O — CID 142406400
N-[4-[(7-imidazol-1-yl-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide (PubChem CID 142406400) has the molecular formula C22H28N8O and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[4-[(7-imidazol-1-yl-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide.
| Compound Name | N-[4-[(7-imidazol-1-yl-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 142406400 |
| Molecular Formula | C22H28N8O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[4-[(7-imidazol-1-yl-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
| SMILES | Cc1nnc2c(NCCCCNC(=O)CC(C)C)nc3cc(-n4ccnc4)ccc3n12 |
| InChI | InChI=1S/C22H28N8O/c1-15(2)12-20(31)24-8-4-5-9-25-21-22-28-27-16(3)30(22)19-7-6-17(13-18(19)26-21)29-11-10-23-14-29/h6-7,10-11,13-15H,4-5,8-9,12H2,1-3H3,(H,24,31)(H,25,26) |
| InChIKey | UQTCXLZNBWFNEE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|