C22H25N7O3 — CID 142406586
N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-2-carboxamide (PubChem CID 142406586) has the molecular formula C22H25N7O3 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-2-carboxamide.
| Compound Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142406586 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-2-carboxamide |
| SMILES | COc1cc2nc(NCCCCNC(=O)c3ccccn3)c3nnc(C)n3c2cc1OC |
| InChI | InChI=1S/C22H25N7O3/c1-14-27-28-21-20(24-10-6-7-11-25-22(30)15-8-4-5-9-23-15)26-16-12-18(31-2)19(32-3)13-17(16)29(14)21/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3,(H,24,26)(H,25,30) |
| InChIKey | GHLKPOMZHVJBMR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|