C14H18N6O — CID 142406709
4-(4-aminobutylamino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-7-ol (PubChem CID 142406709) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 4-(4-aminobutylamino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-7-ol.
| Compound Name | 4-(4-aminobutylamino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-7-ol |
|---|---|
| PubChem CID | 142406709 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-(4-aminobutylamino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-7-ol |
| SMILES | Cc1nnc2c(NCCCCN)nc3cc(O)ccc3n12 |
| InChI | InChI=1S/C14H18N6O/c1-9-18-19-14-13(16-7-3-2-6-15)17-11-8-10(21)4-5-12(11)20(9)14/h4-5,8,21H,2-3,6-7,15H2,1H3,(H,16,17) |
| InChIKey | WULXMXDFDNLBPS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|