About 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile
4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile (PubChem CID 142407569) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile |
| PubChem CID | 142407569 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile |
| SMILES | CC1C=C(C#N)C(=O)C(C)(C)C1OCCO |
| InChI | InChI=1S/C12H17NO3/c1-8-6-9(7-13)10(15)12(2,3)11(8)16-5-4-14/h6,8,11,14H,4-5H2,1-3H3 |
| InChIKey | HAKQUWDWUHIOIZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile?
The IUPAC name of 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile (CID 142407569) is 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile.
What is the SMILES notation for 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile?
The canonical SMILES for 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile is CC1C=C(C#N)C(=O)C(C)(C)C1OCCO.
What is the InChIKey of 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile?
The InChIKey is HAKQUWDWUHIOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-8-6-9(7-13)10(15)12(2,3)11(8)16-5-4-14/h6,8,11,14H,4-5H2,1-3H3.
What are the key properties of 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile?
4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile has a molecular weight of 223.27 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethoxy)-3,5,5-trimethyl-6-oxocyclohexene-1-carbonitrile is sourced from PubChem (CID 142407569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).