About 4-ethyl-5-methyl-1,3-thiazole;methanamine
4-ethyl-5-methyl-1,3-thiazole;methanamine (PubChem CID 142407721) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is 4-ethyl-5-methyl-1,3-thiazole;methanamine.
Molecular Properties
| Compound Name | 4-ethyl-5-methyl-1,3-thiazole;methanamine |
| PubChem CID | 142407721 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 4-ethyl-5-methyl-1,3-thiazole;methanamine |
| SMILES | CCc1ncsc1C.CN |
| InChI | InChI=1S/C6H9NS.CH5N/c1-3-6-5(2)8-4-7-6;1-2/h4H,3H2,1-2H3;2H2,1H3 |
| InChIKey | FFJSDKJEBVBOCP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-5-methyl-1,3-thiazole;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-methyl-1,3-thiazole;methanamine?
The IUPAC name of 4-ethyl-5-methyl-1,3-thiazole;methanamine (CID 142407721) is 4-ethyl-5-methyl-1,3-thiazole;methanamine.
What is the SMILES notation for 4-ethyl-5-methyl-1,3-thiazole;methanamine?
The canonical SMILES for 4-ethyl-5-methyl-1,3-thiazole;methanamine is CCc1ncsc1C.CN.
What is the InChIKey of 4-ethyl-5-methyl-1,3-thiazole;methanamine?
The InChIKey is FFJSDKJEBVBOCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS.CH5N/c1-3-6-5(2)8-4-7-6;1-2/h4H,3H2,1-2H3;2H2,1H3.
What are the key properties of 4-ethyl-5-methyl-1,3-thiazole;methanamine?
4-ethyl-5-methyl-1,3-thiazole;methanamine has a molecular weight of 158.27 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-methyl-1,3-thiazole;methanamine is sourced from PubChem (CID 142407721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).